CymitQuimica logo

CAS 946598-34-1

:

ethyl (trans-4-Boc-aminocyclohexyl)acetate

Description:
Ethyl (trans-4-Boc-aminocyclohexyl)acetate is a chemical compound characterized by its unique structure, which includes an ethyl acetate moiety and a trans-4-Boc-aminocyclohexyl group. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group in organic synthesis, particularly in the context of amines, providing stability and facilitating further reactions. This compound is typically used in organic synthesis and medicinal chemistry, often serving as an intermediate in the preparation of more complex molecules. Its cyclohexyl structure contributes to its steric properties, influencing its reactivity and interactions with biological targets. The presence of the acetate group suggests potential applications in esterification reactions or as a prodrug. Additionally, the trans configuration of the amine substituent can affect the compound's conformational flexibility and overall biological activity. As with many organic compounds, proper handling and storage are essential due to potential reactivity and safety considerations.
Formula:C15H27NO4
InChI:InChI=1S/C15H27NO4/c1-5-19-13(17)10-11-6-8-12(9-7-11)16-14(18)20-15(2,3)4/h11-12H,5-10H2,1-4H3,(H,16,18)
InChI key:GKBUJPUBSPCDGF-UHFFFAOYSA-N
SMILES:CCOC(=O)CC1CCC(CC1)NC(=O)OC(C)(C)C
Synonyms:
  • Ethyl trans-2-[4-(Boc-aminoyclohexyl]acetate
Found 7 products.