CymitQuimica logo

CAS 946605-55-6

:

1-Bromo-2-(2,2-difluoroethoxy)benzene

Description:
1-Bromo-2-(2,2-difluoroethoxy)benzene is an organic compound characterized by the presence of a bromine atom and a difluoroethoxy group attached to a benzene ring. This compound features a bromine substituent at the second position of the benzene, while the ethoxy group, which contains two fluorine atoms, is attached at the para position relative to the bromine. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The difluoroethoxy group enhances the compound's polarity and can influence its solubility in different solvents. Additionally, the fluorine atoms can impart unique electronic properties, affecting the compound's behavior in chemical reactions and interactions with biological systems. This compound may be of interest in fields such as medicinal chemistry, materials science, and agrochemicals due to its potential applications in synthesizing more complex molecules or as a building block in various chemical processes.
Formula:C8H7BrF2O
InChI:InChI=1S/C8H7BrF2O/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,8H,5H2
InChI key:InChIKey=STMKNINOKNUOGI-UHFFFAOYSA-N
SMILES:O(CC(F)F)C1=C(Br)C=CC=C1
Synonyms:
  • 1-Bromo-2-(2,2-difluoroethoxy)benzene
  • Benzene, 1-bromo-2-(2,2-difluoroethoxy)-
  • 2-(2,2-Difluoroethoxy)phenyl bromide
Found 3 products.