CymitQuimica logo

CAS 94670-76-5

:

1,3-Benzodioxole, 5-bromo-6-iodo-

Description:
1,3-Benzodioxole, 5-bromo-6-iodo- is an organic compound characterized by its fused dioxole ring structure, which consists of a benzene ring fused to a dioxole moiety. The presence of bromine and iodine substituents at the 5 and 6 positions, respectively, introduces significant halogen functionality, which can influence the compound's reactivity and physical properties. This compound is typically a colorless to pale yellow solid and may exhibit moderate solubility in organic solvents. Its halogen substituents can enhance its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of these halogens may impart unique biological activities, making it of interest in medicinal chemistry and material science. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C7H4BrIO2
InChI:InChI=1S/C7H4BrIO2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-2H,3H2
InChI key:IKAMVDCUIDIBOG-UHFFFAOYSA-N
SMILES:C1OC2=CC(=C(C=C2O1)I)Br
Found 2 products.