CAS 94691-90-4

1,5-Dioxaspiro[5.5]undec-3-en-2-one

Description:

1,5-Dioxaspiro[5.5]undec-3-en-2-one, with the CAS number 94691-90-4, is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane ring fused to a cyclohexene moiety. This compound features a carbonyl group (ketone) and two ether linkages, contributing to its reactivity and potential applications in organic synthesis. The presence of the spiro configuration imparts distinctive stereochemical properties, influencing its physical and chemical behavior. Typically, compounds of this nature exhibit moderate to low solubility in water but may dissolve in organic solvents. They can participate in various chemical reactions, including nucleophilic additions and cycloadditions, making them valuable intermediates in the synthesis of more complex molecules. Additionally, the unique structural features may confer interesting biological activities, warranting further investigation for potential pharmaceutical applications. Overall, 1,5-Dioxaspiro[5.5]undec-3-en-2-one represents a fascinating subject of study within the field of organic chemistry.

Formula: C₉H₁₂O₃

InChI: InChI=1S/C9H12O3/c10-8-4-7-11-9(12-8)5-2-1-3-6-9/h4,7H,1-3,5-6H2

InChI key: NOQYXTYMYYOSQL-UHFFFAOYSA-N

SMILES: C1CCC2(CC1)OC=CC(=O)O2

1,5-Dioxaspiro[5.5]undec-3-en-2-one

Controlled Product

CAS: 94691-90-4

Applications 1,5-Dioxaspiro[5.5]undec-3-en-2-one (cas# 94691-90-4) is a compound useful in organic synthesis.

Formula: C₉H₁₂O₃

Color and Shape: Neat

Molecular weight: 168.19

Ref: TR-D486310