CAS 947191-69-7
:6-(Cyclopropylmethoxy)pyridine-3-boronic acid pinacol ester
Description:
6-(Cyclopropylmethoxy)pyridine-3-boronic acid pinacol ester is a chemical compound characterized by its boronic acid functionality, which is typically involved in Suzuki coupling reactions, a key method in organic synthesis for forming carbon-carbon bonds. This compound features a pyridine ring, which contributes to its aromatic properties and potential reactivity. The presence of the cyclopropylmethoxy group enhances its steric and electronic characteristics, influencing its reactivity and solubility. The pinacol ester moiety is significant for stabilizing the boronic acid group, making it more suitable for various synthetic applications. This compound is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit moderate stability under standard laboratory conditions. Its unique structure allows for potential applications in medicinal chemistry and materials science, particularly in the development of pharmaceuticals and agrochemicals. As with many boronic acids, it may also participate in complexation with diols and other Lewis bases, further expanding its utility in chemical synthesis.
Formula:C15H22BNO3
InChI:InChI=1/C15H22BNO3/c1-14(2)15(3,4)20-16(19-14)12-7-8-13(17-9-12)18-10-11-5-6-11/h7-9,11H,5-6,10H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(c2ccc(nc2)OCC2CC2)O1
Synonyms:- Pyridine, 2-(Cyclopropylmethoxy)-5-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-
- 2-(Cyclopropylmethoxy)-5-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-(Cyclopropylmethoxy)pyridine-3-boronic acid pinacol ester, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C15H22BNO3Purity:97%Molecular weight:275.162-(Cyclopropylmethoxy)pyridine-5-boronic acid, pinacol ester
CAS:2-(Cyclopropylmethoxy)pyridine-5-boronic acid, pinacol esterFormula:C15H22BNO3Purity:97%Molecular weight:275.151072-(CYCLOPROPYLMETHOXY)-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:Formula:C15H22BNO3Purity:97%Color and Shape:LiquidMolecular weight:275.15112-(Cyclopropylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C15H22BNO3Purity:97%Color and Shape:SolidMolecular weight:275.16




