CAS 94739-29-4
:Lemildipine
Description:
Lemildipine is a pharmaceutical compound classified as a calcium channel blocker, primarily used in the treatment of hypertension and certain types of angina. It belongs to the dihydropyridine class of calcium antagonists, which work by inhibiting the influx of calcium ions into vascular smooth muscle and cardiac cells, leading to vasodilation and reduced blood pressure. Lemildipine is characterized by its long half-life, allowing for once-daily dosing, which enhances patient compliance. The compound exhibits a high degree of selectivity for vascular calcium channels, minimizing effects on cardiac contractility. Its chemical structure includes a dihydropyridine ring, which is essential for its pharmacological activity. Lemildipine is generally well-tolerated, with common side effects including headache, flushing, and peripheral edema. As with other calcium channel blockers, it is contraindicated in patients with certain cardiovascular conditions, such as severe aortic stenosis. Overall, Lemildipine represents an effective option in the management of hypertension, contributing to improved cardiovascular health.
Formula:C20H22Cl2N2O6
InChI:InChI=1S/C20H22Cl2N2O6/c1-9(2)30-19(26)16-13(8-29-20(23)27)24-10(3)14(18(25)28-4)15(16)11-6-5-7-12(21)17(11)22/h5-7,9,15,24H,8H2,1-4H3,(H2,23,27)
InChI key:InChIKey=WTOVRSWDBLIFHU-UHFFFAOYSA-N
SMILES:C(OC(C)C)(=O)C=1C(C(C(OC)=O)=C(C)NC1COC(N)=O)C2=C(Cl)C(Cl)=CC=C2
Synonyms:- NB 818
- NPK 1886
- 3,5-Pyridinedicarboxylic acid, 2-[[(aminocarbonyl)oxy]methyl]-4-(2,3-dichlorophenyl)-1,4-dihydro-6-methyl-, 5-methyl 3-(1-methylethyl) ester
- Lemildipine
- 3-Isopropyl 5-methyl (±)-4-(2,3-dichlorophenyl)-1,4-dihydro-2-(hydroxymethyl)-6-methyl-3,5-pyridinedicarboxylate, carbamate (ester)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Lemildipine
CAS:Lemildipine is a calcium channel blocker drug that blocks voltage-dependent calcium channels in the cell membrane. Lemildipine inhibits the influx of calcium ions into cardiac and smooth muscle cells, which decreases their contractility and reduces blood pressure. It also has been shown to inhibit the release of calcium from the sarcoplasmic reticulum in response to nerve impulses, thereby blocking transmission of these signals to the muscle fibers. This drug has been found to be effective in preventing or treating metabolic disorders such as diabetes. Lemildipine has also been shown to have anti-inflammatory properties and inhibit bowel disease by reducing the amount of water absorbed by the bowel.Formula:C20H22Cl2N2O6Purity:Min. 95%Molecular weight:457.3 g/molLemildipine
CAS:Lemildipine is a new blocker of dihydropyridine calcium entry.Formula:C20H22Cl2N2O6Color and Shape:SolidMolecular weight:457.3




