CAS 947692-14-0
:1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
Description:
The chemical substance known as 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate, with the CAS number 947692-14-0, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters, amides, and thiazole rings. This compound is part of a class of antibiotics known for their activity against bacterial infections. Its structure features a bicyclic core, which is essential for its biological activity, and various substituents that enhance its pharmacological properties. The presence of the thiazole moiety contributes to its mechanism of action, often involving inhibition of bacterial protein synthesis. Additionally, the compound's solubility, stability, and bioavailability are influenced by its functional groups, making it a subject of interest in medicinal chemistry for the development of new therapeutic agents.
Formula:C20H25N5O8S2
InChI:InChI=1S/C20H25N5O8S2/c1-8(2)31-20(29)33-10(4)32-18(28)14-9(3)6-34-17-13(16(27)25(14)17)23-15(26)12(24-30-5)11-7-35-19(21)22-11/h7-8,10,13,17H,6H2,1-5H3,(H2,21,22)(H,23,26)/b24-12-/t10?,13-,17-/m1/s1
InChI key:InChIKey=IETSABQUOKHCMQ-PUONPJMJSA-N
SMILES:C(OC(OC(OC(C)C)=O)C)(=O)C=1N2[C@@]([C@H](NC(/C(=N\OC)/C=3N=C(N)SC3)=O)C2=O)(SCC1C)[H]
Synonyms:- 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-, 1-[[(1-methylethoxy)carbonyl]oxy]ethyl ester, (6R,7R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Cefpodoxime Proxetil EP Impurity B (Mixture of Diastereomers)
CAS:Formula:C20H25N5O8S2Color and Shape:Off-White SolidMolecular weight:527.58Cefpodoxime proxetil impurity B
CAS:Impurity B in Cefpodoxime Proxetil, a broad-spectrum oral antibiotic, is a third-generation cephalosporin.Formula:C20H25N5O8S2Color and Shape:SolidMolecular weight:527.573-Methyl 3-De(methoxymethyl) Cefpodoxime
CAS:Controlled ProductImpurity Cefpodoxime Proxetil EP Impurity B
Applications 3-Methyl 3-De(methoxymethyl) Cefpodoxime (Cefpodoxime Proxetil EP Impurity B) is an impurity of Cefpodoxime Proxetil (C243860) which is an antibacterial.
References Fujimoto, K., et al.: J. Antibiot., 40, 370 (1987); Utsui, Y., et al.: Antimicrob. Agents Chemother., 31, 1085 (1987)Formula:C20H25N5O8S2Color and Shape:NeatMolecular weight:527.57



