CAS 947692-14-0

1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate

Description:

The chemical substance known as 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate, with the CAS number 947692-14-0, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters, amides, and thiazole rings. This compound is part of a class of antibiotics known for their activity against bacterial infections. Its structure features a bicyclic core, which is essential for its biological activity, and various substituents that enhance its pharmacological properties. The presence of the thiazole moiety contributes to its mechanism of action, often involving inhibition of bacterial protein synthesis. Additionally, the compound's solubility, stability, and bioavailability are influenced by its functional groups, making it a subject of interest in medicinal chemistry for the development of new therapeutic agents.

Formula: C₂₀H₂₅N₅O₈S₂

InChI: InChI=1S/C20H25N5O8S2/c1-8(2)31-20(29)33-10(4)32-18(28)14-9(3)6-34-17-13(16(27)25(14)17)23-15(26)12(24-30-5)11-7-35-19(21)22-11/h7-8,10,13,17H,6H2,1-5H3,(H2,21,22)(H,23,26)/b24-12-/t10?,13-,17-/m1/s1

InChI key: InChIKey=IETSABQUOKHCMQ-PUONPJMJSA-N

SMILES: C(OC(OC(OC(C)C)=O)C)(=O)C=1N2[C@@]([C@H](NC(/C(=N\OC)/C=3N=C(N)SC3)=O)C2=O)(SCC1C)[H]

Synonyms:

• 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
• 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-, 1-[[(1-methylethoxy)carbonyl]oxy]ethyl ester, (6R,7R)-

Cefpodoxime Proxetil EP Impurity B (Mixture of Diastereomers)

CAS: 947692-14-0

Formula: C₂₀H₂₅N₅O₈S₂

Color and Shape: Off-White Solid

Molecular weight: 527.58

Ref: 4Z-C-853

Cefpodoxime proxetil impurity B

CAS: 947692-14-0

Impurity B in Cefpodoxime Proxetil, a broad-spectrum oral antibiotic, is a third-generation cephalosporin.

Formula: C₂₀H₂₅N₅O₈S₂

Color and Shape: Solid

Molecular weight: 527.57

Ref: TM-T41106

Cefpodoxime Proxetil EP Impurity B

CAS: 947692-14-0

Formula: C₂₀H₂₅N₅O₈S₂

Molecular weight: 527.57

Ref: ST-EA-CP-C156002

3-Methyl 3-De(methoxymethyl) Cefpodoxime

Controlled Product

CAS: 947692-14-0

Impurity Cefpodoxime Proxetil EP Impurity B
Applications 3-Methyl 3-De(methoxymethyl) Cefpodoxime (Cefpodoxime Proxetil EP Impurity B) is an impurity of Cefpodoxime Proxetil (C243860) which is an antibacterial.
References Fujimoto, K., et al.: J. Antibiot., 40, 370 (1987); Utsui, Y., et al.: Antimicrob. Agents Chemother., 31, 1085 (1987)

Formula: C₂₀H₂₅N₅O₈S₂

Color and Shape: Neat

Molecular weight: 527.57

Ref: TR-M295700