CymitQuimica logo

CAS 947692-14-0

:

1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate

Description:
The chemical substance known as 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate, with the CAS number 947692-14-0, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters, amides, and thiazole rings. This compound is part of a class of antibiotics known for their activity against bacterial infections. Its structure features a bicyclic core, which is essential for its biological activity, and various substituents that enhance its pharmacological properties. The presence of the thiazole moiety contributes to its mechanism of action, often involving inhibition of bacterial protein synthesis. Additionally, the compound's solubility, stability, and bioavailability are influenced by its functional groups, making it a subject of interest in medicinal chemistry for the development of new therapeutic agents.
Formula:C20H25N5O8S2
InChI:InChI=1S/C20H25N5O8S2/c1-8(2)31-20(29)33-10(4)32-18(28)14-9(3)6-34-17-13(16(27)25(14)17)23-15(26)12(24-30-5)11-7-35-19(21)22-11/h7-8,10,13,17H,6H2,1-5H3,(H2,21,22)(H,23,26)/b24-12-/t10?,13-,17-/m1/s1
InChI key:InChIKey=IETSABQUOKHCMQ-PUONPJMJSA-N
SMILES:C(OC(OC(OC(C)C)=O)C)(=O)C=1N2[C@@]([C@H](NC(/C(=N\OC)/C=3N=C(N)SC3)=O)C2=O)(SCC1C)[H]
Synonyms:
  • 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
  • 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-, 1-[[(1-methylethoxy)carbonyl]oxy]ethyl ester, (6R,7R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.