CymitQuimica logo

CAS 94770-75-9

:

2-chloropyridin-3-amine hydrochloride

Description:
2-Chloropyridin-3-amine hydrochloride is an organic compound characterized by its pyridine ring structure, which contains a chlorine atom and an amino group at specific positions. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents due to the presence of the hydrochloride salt form, which enhances its solubility. It exhibits basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the chlorine atom can also influence its reactivity and biological activity, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 2-chloropyridin-3-amine hydrochloride may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C5H5ClN2ClH
InChI:InChI=1S/C5H5ClN2.ClH/c6-5-4(7)2-1-3-8-5;/h1-3H,7H2;1H
InChI key:NEQIRASUEZEXJF-UHFFFAOYSA-N
SMILES:C1=CC(=C(N=C1)Cl)N.Cl
Synonyms:
  • 3-Pyridinamine, 2-chloro-, hydrochloride (1:1)
  • 3-Pyridinamine,2-chloro-, monohydrochloride
  • 2-Chloro-3-pyridinamine hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.