CymitQuimica logo

CAS 947770-80-1

:

Dibenzofuran, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
Dibenzofuran, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, identified by CAS number 947770-80-1, is an organic compound that features a dibenzofuran core structure substituted with a boron-containing group. This compound typically exhibits characteristics associated with both aromatic and boron-containing compounds, including potential applications in organic synthesis and materials science. The presence of the dioxaborolane moiety suggests that it may participate in various chemical reactions, such as cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the tetramethyl substitution enhances its stability and solubility in organic solvents. The compound may also display interesting photophysical properties, making it a candidate for use in optoelectronic applications. As with many boron-containing compounds, it is essential to handle it with care, considering potential reactivity and toxicity. Overall, this compound represents a unique intersection of organic chemistry and materials science, with potential utility in advanced chemical applications.
Formula:C18H19BO3
InChI:InChI=1S/C18H19BO3/c1-17(2)18(3,4)22-19(21-17)12-9-10-16-14(11-12)13-7-5-6-8-15(13)20-16/h5-11H,1-4H3
InChI key:GDWJKTGSLLXSHE-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC4=CC=CC=C43
Found 4 products.