CymitQuimica logo

CAS 94781-89-2

:

1-Hydroxy-6-oxo-1,6-dihydro-pyridine-2-carboxylic acid

Description:
1-Hydroxy-6-oxo-1,6-dihydro-pyridine-2-carboxylic acid, also known by its CAS number 94781-89-2, is a heterocyclic organic compound characterized by a pyridine ring with specific functional groups. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the pyridine structure, contributing to its acidic properties. The presence of the keto group (C=O) at the 6-position enhances its reactivity and potential for forming various derivatives. It is typically a white to off-white solid and is soluble in polar solvents, which is indicative of its functional groups. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C6H5NO4
InChI:InChI=1S/C6H5NO4/c8-5-3-1-2-4(6(9)10)7(5)11/h1-3,11H,(H,9,10)
InChI key:QJEZBSWVHDOAFS-UHFFFAOYSA-N
SMILES:C1=CC(=O)N(C(=C1)C(=O)O)O
Synonyms:
  • 1-Hydroxy-6-Oxo-1,6-Dihydropyridine-2-Carboxylic Acid
Found 4 products.