CymitQuimica logo

CAS 94787-97-0

:

Hexanamide, 2-amino-,monohydrochloride, (S)-

Description:
Hexanamide, 2-amino-, monohydrochloride, (S)-, also known by its CAS number 94787-97-0, is a chiral amide compound characterized by the presence of an amino group and a hexanamide backbone. This substance typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The (S)- designation indicates that it has a specific stereochemistry, which can influence its biological activity and interactions in various chemical environments. Hexanamide derivatives are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on its specific structure and the presence of functional groups. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique characteristics and potential applications.
Formula:C6H14N2O・ClH
InChI:InChI=1S/C6H14N2O.ClH/c1-2-3-4-5(7)6(8)9;/h5H,2-4,7H2,1H3,(H2,8,9);1H/t5-;/m0./s1
InChI key:SPTYYKPZSWYQDT-JEDNCBNOSA-N
SMILES:CCCC[C@@H](C(=O)N)N.Cl
Synonyms:
  • Norleucinamide,DL-, hydrochloride
  • L-Norleucine amide hydrochloride
  • H-Nle-Nh2 Hcl
  • H-Nle-NH2・HCl
Found 5 products.