CymitQuimica logo

CAS 948033-75-8

:

tert-butyl 5,6-dimethoxy- 3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-caboxylate

Description:
Tert-butyl 5,6-dimethoxy-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, with the CAS number 948033-75-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a spirocyclic framework. This compound features a tert-butyl group, contributing to its hydrophobic properties, and two methoxy groups that enhance its solubility and reactivity. The presence of a carbonyl group (3-oxo) indicates potential for reactivity in various chemical transformations, such as nucleophilic additions. The indene and piperidine moieties suggest potential biological activity, making it of interest in medicinal chemistry. Its unique structure may also impart specific physical properties, such as melting point and solubility, which are important for its application in research or pharmaceuticals. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry, with potential implications in drug development and other chemical applications.
Formula:C20H27NO5
InChI:InChI=1S/C20H27NO5/c1-19(2,3)26-18(23)21-8-6-20(7-9-21)12-15(22)13-10-16(24-4)17(25-5)11-14(13)20/h10-11H,6-9,12H2,1-5H3
InChI key:ZLVHLKCLZIAUKY-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=CC(=C(C=C23)OC)OC
Synonyms:
  • tert-Butyl 5,6-dimethoxy-3-oxo- 2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate
Found 3 products.