CAS 94856-25-4
:2,5-Furandione,3-[1-(2,5-dimethyl-3-furanyl)ethylidene]dihydro-4-tricyclo[3.3.1.13,7]decylidene-,(3E)-
Description:
2,5-Furandione, 3-[1-(2,5-dimethyl-3-furanyl)ethylidene]dihydro-4-tricyclo[3.3.1.13,7]decylidene-, (3E)-, with CAS number 94856-25-4, is a complex organic compound characterized by its unique structural features, including a furan ring and multiple fused ring systems. This compound exhibits a high degree of molecular complexity due to the presence of tricyclic structures, which can influence its physical and chemical properties, such as solubility, stability, and reactivity. The furan moiety contributes to its potential reactivity, particularly in electrophilic substitution reactions. Additionally, the presence of multiple methyl groups may enhance its hydrophobic characteristics, affecting its interaction with biological systems and solvents. The stereochemistry indicated by the (3E) designation suggests specific geometric arrangements that can impact its biological activity and interactions. Overall, this compound may have applications in fields such as materials science, pharmaceuticals, or organic synthesis, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C22H24O4
InChI:InChI=1S/C22H24O4/c1-10-4-17(12(3)25-10)11(2)18-20(22(24)26-21(18)23)19-15-6-13-5-14(8-15)9-16(19)7-13/h4,13-16H,5-9H2,1-3H3/b18-11+,20-19?
InChI key:OOVNPWVABCFZRY-HJJJESHSSA-N
SMILES:CC1=CC(=C(O1)C)/C(=C/2\C(=C3C4CC5CC(C4)CC3C5)C(=O)OC2=O)/C
Synonyms:- Aberchrome670
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Aberchrome 670
CAS:Formula:C22H24O4Purity:95%Color and Shape:SolidMolecular weight:352.42355999999984Aberchrome 670
CAS:Aberchrom 670 is a surface active agent that can be used in the production of coatings and other devices. It has a high solubility parameter, which means it has a low surface tension and can form films on water surfaces. Aberchrom 670 is an amphiphilic molecule, which means it has both hydrophobic and hydrophilic parts. This property allows for the formation of films on water surfaces, making it useful in applications such as coating and device manufacturing. The phase transition temperature of Aberchrom 670 is higher than room temperature, so it will not melt when exposed to UV radiation. Aberchrom 670 also fluoresces under UV irradiation, allowing for easy detection during manufacturing processes.Formula:C22H24O4Purity:(%) Min. 95%Color and Shape:Orange PowderMolecular weight:352.42 g/mol



