CAS 948574-00-3

Formula: C19H22N2O9

InChI: InChI=1S/C19H22N2O9/c1-9-6-10(27-2)7-11(28-3)14(9)18(25)30-16-12(8-22)29-17(15(16)24)21-5-4-13(23)20-19(21)26/h4-7,12,15-17,22,24H,8H2,1-3H3,(H,20,23,26)/t12-,15-,16-,17-/m1/s1

InChI key: LQYPUZKOEZWGBX-BASLNEPJSA-N

SMILES: CC1=CC(=CC(=C1C(=O)O[C@@H]2[C@H](O[C@H]([C@@H]2O)N3C=CC(=O)NC3=O)CO)OC)OC

Kipukasin D

CAS: 948574-00-3

Kipukasin D

Molecular weight: 422.13

Ref: 10-F565626

Kipukasin D

CAS: 948574-00-3

Kipukasin D is a naturally derived nucleoside with antibacterial properties, isolated from Aspergillus versicolor.

Formula: C₁₉H₂₂N₂O₉

Color and Shape: Solid

Molecular weight: 422.39

Ref: TM-T41107

Kipukasin D

CAS: 948574-00-3

Kipukasin D is a biopesticide, which is derived from natural fungal sources with a targeted mode of action on pest-specific ion channels. Kipukasin D modulates the functionality of these ion channels, leading to disruption of neural and muscular communication in target pest organisms. This disruption results in impaired physiological functions and ultimately pest mortality. The specificity of Kipukasin D allows it to target harmful pest species while minimizing impacts on non-target organisms and ecosystems.

Formula: C₁₉H₂₂N₂O₉

Purity: Min. 95%

Molecular weight: 422.39 g/mol

Ref: 3D-YMB57400