CymitQuimica logo

CAS 948594-79-4

:

Tert-Butyl Methyl 2-(5-Bromopyrimidin-2-Yl)Malonate

Description:
Tert-Butyl Methyl 2-(5-Bromopyrimidin-2-Yl)Malonate is a chemical compound characterized by its unique structure, which includes a tert-butyl group, a methyl ester, and a pyrimidine ring substituted with a bromine atom. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The presence of the bromine atom enhances its reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the malonate moiety contributes to its potential as a building block in the synthesis of biologically active compounds. The compound is generally stable under standard conditions but should be handled with care due to the presence of the bromine atom, which can impart toxicity. As with many organic compounds, proper storage and handling protocols should be followed to ensure safety and maintain its integrity for research and application purposes.
Formula:C12H15BrN2O4
InChI:InChI=1S/C12H15BrN2O4/c1-12(2,3)19-11(17)8(10(16)18-4)9-14-5-7(13)6-15-9/h5-6,8H,1-4H3
InChI key:ATYNGAOEFUBJIW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C(C1=NC=C(C=N1)Br)C(=O)OC
Synonyms:
  • 1-(tert-Butyl) 3-methyl 2-(5-bromopyrimidin-2-yl)malonate
  • Tert-Butyl Methyl 2-(5-Bromopyrimidin-2-Yl)Malonate
  • Tert-Butyl Methyl 2-(5-Bromopyrimidin-2-Yl)Malonate(WX637401)
  • Propanedioic acid, 2-(5-bromo-2-pyrimidinyl)-, 1-(1,1-dimethylethyl) 3-methyl ester
  • methyl tert-butyl 2-(5-bromopyrimidin-2-yl)propanedioate
Found 2 products.