CymitQuimica logo

CAS 948883-29-2

:

IMidazo[1,2-a]pyridine-6-propanenitrile, b-oxo-

Description:
Imidazo[1,2-a]pyridine-6-propanenitrile, b-oxo- is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyridine rings. This compound features a propanenitrile group, contributing to its potential reactivity and applications in various chemical contexts. The presence of the b-oxo functional group indicates that it may exhibit keto-enol tautomerism, which can influence its chemical behavior and interactions. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential biological activity, including antimicrobial or anticancer properties. The molecular structure allows for various substitution patterns, which can be explored to enhance efficacy or selectivity in biological systems. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research and development in pharmaceutical applications. Overall, Imidazo[1,2-a]pyridine-6-propanenitrile, b-oxo- represents a versatile scaffold for the design of novel therapeutic agents.
Formula:C10H7N3O
InChI:InChI=1S/C10H7N3O/c11-4-3-9(14)8-1-2-10-12-5-6-13(10)7-8/h1-2,5-7H,3H2
InChI key:MTERNIBSEZLQFD-UHFFFAOYSA-N
SMILES:C1=CC2=NC=CN2C=C1C(=O)CC#N
Found 4 products.