CAS 949095-98-1
:4-[3-(Methylamino)-1-(2-thienyl)propyl]-1-naphthalenol
Description:
4-[3-(Methylamino)-1-(2-thienyl)propyl]-1-naphthalenol, identified by its CAS number 949095-98-1, is a chemical compound that features a complex structure comprising a naphthalene moiety and a thienyl group. This compound is characterized by the presence of a hydroxyl group (-OH) attached to the naphthalene ring, which contributes to its potential as a phenolic compound. The methylamino group introduces basicity, while the thienyl component adds to its aromatic character and may influence its biological activity. The compound's structure suggests it may exhibit interesting pharmacological properties, potentially acting as a ligand for various receptors. Its solubility and reactivity can be influenced by the functional groups present, making it of interest in medicinal chemistry and drug development. Additionally, the presence of both hydrophobic and hydrophilic regions in its structure may affect its interactions with biological membranes and proteins. Overall, this compound represents a unique blend of structural features that could be explored for various applications in research and industry.
Formula:C18H19NOS
InChI:InChI=1S/C18H19NOS/c1-19-11-10-16(18-7-4-12-21-18)14-8-9-17(20)15-6-3-2-5-13(14)15/h2-9,12,16,19-20H,10-11H2,1H3
InChI key:InChIKey=OJXMJLCWKLPCHB-UHFFFAOYSA-N
SMILES:C(CCNC)(C=1C2=C(C(O)=CC1)C=CC=C2)C3=CC=CS3
Synonyms:- 1-Naphthalenol, 4-[3-(methylamino)-1-(2-thienyl)propyl]-
- 4-[3-(Methylamino)-1-(2-thienyl)propyl]-1-naphthalenol
- Para-Naphthol duloxetine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Duloxetine metabolite Para-Naphthol Duloxetine
CAS:Duloxetine metabolite Para-Naphthol DuloxetineFormula:C18H19NOSPurity:≥98%Molecular weight:297.424-[(1RS)-3-(Methylamino)-1-(thiophen-2-yl)propyl]naphthalen-1-ol
CAS:Controlled ProductFormula:C18H19NOSColor and Shape:NeatMolecular weight:297.42Para-Naphthol Duloxetine
CAS:Controlled ProductImpurity Duloxetine EP Impurity F
Applications Para-Naphthol Duloxetine is an impurity of Duloxetine (D721000), an antidepressant and a dual serotonin and norepinephrine reuptake inhibitor (SNRI) (1,2). Exhibits linear pharmacokinetics in mice and is not associated in any drastic changes of blood pressure or heart rate (3).
References 1. Wong, D. et al.: Neuropsychopharmacology. 1993 Jan;8(1):23-33.2. Fuller, R. et al.: J Pharmacol Exp Ther. 1994 Apr;269(1):132-6. 3. Sharma, A. et al.: J Clin Pharmacol. 2000 Feb;40(2):161-7.Formula:C18H19NOSColor and Shape:NeatMolecular weight:297.42(RS)-4-(3-METHYLAMINO-1-THIOPHEN-2-YL-PROPYL)-NAPHTHALEN-1-OL
CAS:Purity:97%Molecular weight:297.4200134Para-Naphthol Duloxetine
CAS:Duloxetine metabolite Para-Naphthol Duloxetine is an inactive metabolite of Duloxetine. Duloxetine is a serotonin-norepinephrine reuptake inhibitor (SNRI).Formula:C18H19NOSPurity:99.61%Color and Shape:SolidMolecular weight:297.42






