CymitQuimica logo

CAS 949449-09-6

:

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)prop-2-enoate

Description:
Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)prop-2-enoate, identified by its CAS number 949449-09-6, is an organic compound characterized by its ester functional group and a conjugated double bond system. This compound features a phenolic moiety with a fluorine substituent at the 5-position and a hydroxyl group at the 2-position, contributing to its potential biological activity. The ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the double bond in the prop-2-enoate structure indicates that it can participate in various chemical reactions, such as polymerization or Michael addition. Additionally, the fluorine atom may influence the compound's lipophilicity and metabolic stability, which are important factors in drug design. Overall, this compound's unique structural features suggest potential utility in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C11H11O3F
InChI:InChI=1S/C11H11FO3/c1-2-15-11(14)6-3-8-7-9(12)4-5-10(8)13/h3-7,13H,2H2,1H3/b6-3+
InChI key:WPJUITWUKANQHJ-ZZXKWVIFSA-N
SMILES:CCOC(=O)/C=C/C1=C(C=CC(=C1)F)O
Synonyms:
  • (E)-Ethyl 3-(5-fluoro-2-hydroxyphenyl)acrylate
Found 2 products.