CymitQuimica logo

CAS 94987-08-3

:

GypenosideXLIX

Description:
Gypenoside XLIX is a saponin compound primarily derived from the root of the plant Panax ginseng, a member of the Araliaceae family. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and neuroprotective effects. Gypenoside XLIX is characterized by its complex glycosidic structure, which contributes to its biological activity. The compound is often studied for its role in enhancing cognitive function and its potential therapeutic applications in various diseases, including neurodegenerative disorders. Additionally, it may exhibit effects on the immune system and metabolic processes. As a natural product, Gypenoside XLIX is of interest in both traditional medicine and modern pharmacology, with ongoing research aimed at elucidating its mechanisms of action and potential health benefits. Its CAS number, 94987-08-3, is used for identification in chemical databases and regulatory contexts. Overall, Gypenoside XLIX represents a significant area of study within the field of natural product chemistry and pharmacognosy.
Formula:C52H86O21
InChI:InChI=1S/C52H86O21/c1-24(2)9-8-15-52(65,23-68-45-40(63)38(61)36(59)30(19-53)70-45)27-12-16-49(6)26(27)10-11-32-50(49,7)17-13-31-48(4,5)33(14-18-51(31,32)22-54)71-47-43(73-46-41(64)37(60)34(57)25(3)69-46)42(29(56)21-67-47)72-44-39(62)35(58)28(55)20-66-44/h9,22,25-47,53,55-65H,8,10-21,23H2,1-7H3/t25-,26+,27-,28+,29-,30+,31-,32-,33-,34-,35-,36+,37+,38-,39+,40+,41+,42-,43+,44-,45+,46-,47-,49+,50+,51+,52+/m0/s1
InChI key:AFEVCSJFNQWWDF-AZFNEDKCSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@H]3CC[C@@]4([C@H]5CC[C@@H]6[C@H](CC[C@]6([C@@]5(CC[C@H]4C3(C)C)C)C)[C@@](CCC=C(C)C)(CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)C=O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)O)O
Synonyms:
  • Gypenoside XLIX
Found 11 products.