CAS 94987-09-4
:Gypenoside L
Description:
Gypenoside L is a saponin compound primarily derived from the root of the plant Panax ginseng, known for its various pharmacological properties. It is characterized by its complex glycosidic structure, which typically includes a steroid-like aglycone and multiple sugar moieties. Gypenoside L is recognized for its potential health benefits, including anti-inflammatory, antioxidant, and immunomodulatory effects. It has been studied for its role in enhancing cognitive function and promoting overall well-being. The compound exhibits solubility in polar solvents, which is common for saponins, and its bioactivity is often attributed to its ability to interact with cell membranes and modulate various signaling pathways. Additionally, Gypenoside L is of interest in the field of traditional medicine and herbal supplements, where it is often explored for its therapeutic potential in various health conditions. As with many natural products, further research is ongoing to fully elucidate its mechanisms of action and potential applications in modern medicine.
Formula:C42H72O14
InChI:InChI=1S/C42H72O14/c1-20(2)10-9-13-42(8,52)21-11-14-41(7)28(21)22(45)16-27-39(5)17-23(46)35(38(3,4)26(39)12-15-40(27,41)6)56-37-34(32(50)30(48)25(19-44)54-37)55-36-33(51)31(49)29(47)24(18-43)53-36/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23+,24+,25+,26-,27+,28-,29+,30+,31-,32-,33+,34+,35-,36-,37-,39-,40+,41+,42-/m0/s1
InChI key:InChIKey=LTJZMSTVPKBWKB-HGZKDYFJSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](CCC=C(C)C)(C)O)(CC3)[H])([C@H](O)C[C@@]1([C@]4(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]5[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@@H](O)[C@H](O)[C@@H](CO)O5)[C@H](O)C4)[H])[H])[H]
Synonyms:- (2α,3β,12β)-2,12,20-Trihydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- Gypenoside L
- β-D-Glucopyranoside, (2α,3β,12β)-2,12,20-trihydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Gypenoside L (Standard)
CAS:Gypenoside L (Standard) is a reference standard for research and analysis in studies involving Gypenoside L. Gypenoside L inhibits autophagic flux and induces cell death in human esophageal cancer cells through endoplasm reticulum stress-mediated Ca2+ release. It also inhibit non-small cell lung carcinoma A549 cell inhibitory activity.Formula:C42H72O14Color and Shape:SolidMolecular weight:801.01Gypenoside L
CAS:Gypenoside L inhibits autophagic flux and induces cell death in human esophageal cancer cells through endoplasm reticulum stress-mediated Ca2+ release.Formula:C42H72O14Purity:99.42% - 99.65%Color and Shape:SolidMolecular weight:801.01Gypenoside L
CAS:Gypenoside L is a saponin compound, which is a secondary metabolite derived from the plant Gynostemma pentaphyllum. This herbaceous plant, commonly known as Jiaogulan, is native to South China and other parts of Asia, where it has been traditionally used in herbal medicine. The mode of action of Gypenoside L involves modulating various biochemical pathways, potentially influencing cellular signaling and metabolic processes. It is known for its role in activating AMP-activated protein kinase (AMPK) pathways, enhancing cellular energy homeostasis, and exhibiting antioxidant properties.Formula:C42H72O14Purity:Min. 95%Molecular weight:801.01 g/mol




