CymitQuimica logo

CAS 94987-09-4

:

Gypenoside L

Description:
Gypenoside L is a saponin compound primarily derived from the root of the plant Panax ginseng, known for its various pharmacological properties. It is characterized by its complex glycosidic structure, which typically includes a steroid-like aglycone and multiple sugar moieties. Gypenoside L is recognized for its potential health benefits, including anti-inflammatory, antioxidant, and immunomodulatory effects. It has been studied for its role in enhancing cognitive function and promoting overall well-being. The compound exhibits solubility in polar solvents, which is common for saponins, and its bioactivity is often attributed to its ability to interact with cell membranes and modulate various signaling pathways. Additionally, Gypenoside L is of interest in the field of traditional medicine and herbal supplements, where it is often explored for its therapeutic potential in various health conditions. As with many natural products, further research is ongoing to fully elucidate its mechanisms of action and potential applications in modern medicine.
Formula:C42H72O14
InChI:InChI=1S/C42H72O14/c1-20(2)10-9-13-42(8,52)21-11-14-41(7)28(21)22(45)16-27-39(5)17-23(46)35(38(3,4)26(39)12-15-40(27,41)6)56-37-34(32(50)30(48)25(19-44)54-37)55-36-33(51)31(49)29(47)24(18-43)53-36/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23+,24+,25+,26-,27+,28-,29+,30+,31-,32-,33+,34+,35-,36-,37-,39-,40+,41+,42-/m0/s1
InChI key:InChIKey=LTJZMSTVPKBWKB-HGZKDYFJSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](CCC=C(C)C)(C)O)(CC3)[H])([C@H](O)C[C@@]1([C@]4(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]5[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@@H](O)[C@H](O)[C@@H](CO)O5)[C@H](O)C4)[H])[H])[H]
Synonyms:
  • (2α,3β,12β)-2,12,20-Trihydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
  • Gypenoside L
  • β-D-Glucopyranoside, (2α,3β,12β)-2,12,20-trihydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
Found 7 products.