CymitQuimica logo

CAS 949922-62-7

:

tert-butyl 2-bromo-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate

Description:
Tert-butyl 2-bromo-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate is a chemical compound characterized by its complex structure, which includes a thieno[3,2-c]pyridine core, a bromine substituent, and a tert-butyl ester functional group. This compound typically exhibits moderate to high lipophilicity due to the presence of the tert-butyl group, which can influence its solubility in organic solvents. The bromine atom introduces a halogen functionality that can participate in various chemical reactions, such as nucleophilic substitutions. The thieno[3,2-c]pyridine moiety is known for its potential biological activity, making this compound of interest in medicinal chemistry. Its carboxylate ester form may enhance stability and bioavailability. Additionally, the compound's unique structural features may contribute to specific interactions with biological targets, which could be explored in drug development. Overall, tert-butyl 2-bromo-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate represents a versatile scaffold for further chemical modifications and applications in pharmaceutical research.
Formula:C12H16BrNO2S
InChI:InChI=1/C12H16BrNO2S/c1-12(2,3)16-11(15)14-5-4-9-8(7-14)6-10(13)17-9/h6H,4-5,7H2,1-3H3
InChI key:ALVKHVFHUNINLV-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCc2c(cc(Br)s2)C1
Found 4 products.