CymitQuimica logo

CAS 94994-25-9

:

Bicyclo[2.2.2]octane-1-carboxylic acid, 4-formyl-, methyl ester

Description:
Bicyclo[2.2.2]octane-1-carboxylic acid, 4-formyl-, methyl ester, identified by CAS number 94994-25-9, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.2]octane framework. This compound features a carboxylic acid functional group and an aldehyde group, with a methyl ester substituent, contributing to its reactivity and potential applications in organic synthesis. The bicyclic structure imparts unique steric and electronic properties, making it of interest in various chemical reactions, including esterification and condensation reactions. The presence of the formyl group suggests potential for further functionalization, allowing for the synthesis of more complex molecules. Additionally, the compound's physical properties, such as solubility and boiling point, are influenced by its functional groups and bicyclic nature. Overall, this compound may serve as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, highlighting its significance in organic chemistry and materials science.
Formula:C11H16O3
InChI:InChI=1S/C11H16O3/c1-14-9(13)11-5-2-10(8-12,3-6-11)4-7-11/h8H,2-7H2,1H3
InChI key:KNSYWHCOJRHWRP-UHFFFAOYSA-N
SMILES:COC(=O)C12CCC(CC1)(CC2)C=O
Found 6 products.