CymitQuimica logo

CAS 94994-62-4

:

2-Bromo-9-phenyl-9H-carbazole

Description:
2-Bromo-9-phenyl-9H-carbazole is an organic compound characterized by its structure, which includes a carbazole core substituted with a bromine atom at the 2-position and a phenyl group at the 9-position. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for π-π stacking interactions due to its planar structure. It is likely to be a solid at room temperature, with moderate solubility in organic solvents. The presence of the bromine atom introduces halogen characteristics, which can influence its reactivity, making it suitable for various chemical transformations, including nucleophilic substitutions. Additionally, the phenyl group can enhance the compound's electronic properties, potentially making it useful in applications such as organic electronics, photonics, or as a building block in organic synthesis. Its unique structure may also confer interesting photophysical properties, making it a candidate for studies in fluorescence or phosphorescence. Overall, 2-Bromo-9-phenyl-9H-carbazole is a versatile compound with potential applications in materials science and organic chemistry.
Formula:C18H12BrN
InChI:InChI=1S/C18H12BrN/c19-13-10-11-16-15-8-4-5-9-17(15)20(18(16)12-13)14-6-2-1-3-7-14/h1-12H
InChI key:SOODLDGRGXOSTA-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)N2C3=CC=CC=C3C4=C2C=C(C=C4)Br
Synonyms:
  • 9H-Carbazole, 2-bromo-9-phenyl-
  • 2-Bromo-9-phenylcarbazole
Found 5 products.