CymitQuimica logo

CAS 950-58-3

:

4-amino-2,6-di-tert-butylphenol

Description:
4-Amino-2,6-di-tert-butylphenol, with the CAS number 950-58-3, is an organic compound characterized by its phenolic structure, which includes an amino group and two tert-butyl substituents. This compound typically appears as a solid at room temperature and is known for its antioxidant properties, making it valuable in various industrial applications, particularly in the stabilization of polymers and plastics against oxidative degradation. The presence of the amino group enhances its reactivity, allowing it to participate in various chemical reactions, while the bulky tert-butyl groups contribute to its steric hindrance, influencing its solubility and reactivity. Additionally, this compound exhibits good thermal stability, which is advantageous in high-temperature applications. Its safety profile indicates that it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4-amino-2,6-di-tert-butylphenol is significant in materials science and chemical manufacturing due to its functional properties and effectiveness as an antioxidant.
Formula:C14H23NO
InChI:InChI=1/C14H23NO/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,16H,15H2,1-6H3
InChI key:MNDTVJMRXYKBPV-UHFFFAOYSA-N
SMILES:CC(C)(C)c1cc(cc(c1O)C(C)(C)C)N
Synonyms:
  • Phenol, 4-Amino-2,6-Bis(1,1-Dimethylethyl)-
Found 4 products.