CymitQuimica logo

CAS 950252-65-0

:

2-(1-oxoisoindolin-2-yl)butanoic acid

Description:
2-(1-Oxoisoindolin-2-yl)butanoic acid is a chemical compound characterized by its unique structure, which includes an isoindoline moiety and a butanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the carbonyl group in the isoindoline structure can influence its hydrogen bonding capabilities and solubility in various solvents. As a carboxylic acid, it is likely to exhibit acidic behavior, allowing it to participate in acid-base reactions. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential for interactions with biological targets, which could be explored in pharmacological studies. Overall, 2-(1-oxoisoindolin-2-yl)butanoic acid is a compound of interest due to its structural features and potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c1-2-10(12(15)16)13-7-8-5-3-4-6-9(8)11(13)14/h3-6,10H,2,7H2,1H3,(H,15,16)
InChI key:KOISFQPSDTYGKX-UHFFFAOYSA-N
SMILES:CCC(C(=O)O)N1Cc2ccccc2C1=O
Found 1 products.