CAS 95058-77-8
:2-deoxy-2,2-difluoro-D-erythro-Pentonic acid gamma-Lactone
Description:
2-Deoxy-2,2-difluoro-D-erythro-pentonic acid gamma-lactone, with the CAS number 95058-77-8, is a chemical compound characterized by its unique structural features, including the presence of two fluorine atoms and a lactone functional group. This compound is derived from pentonic acid, specifically in its D-erythro configuration, which influences its stereochemistry and biological activity. The lactone form indicates that it is a cyclic ester, formed through the reaction of a hydroxyl group with a carboxylic acid group within the same molecule, leading to a stable ring structure. The difluorination introduces significant changes in its chemical properties, potentially enhancing its reactivity and interactions with biological systems. Such modifications can affect its solubility, stability, and overall pharmacological profile. Compounds like this may be of interest in medicinal chemistry and drug design, particularly for their potential applications in targeting specific biological pathways or as intermediates in synthetic processes. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C5H6F2O4
InChI:InChI=1S/C5H6F2O4/c6-5(7)3(9)2(1-8)11-4(5)10/h2-3,8-9H,1H2/t2-,3-/m1/s1
InChI key:FBXJTMLCLDWDQO-PWNYCUMCSA-N
SMILES:C([C@@H]1[C@H](C(C(=O)O1)(F)F)O)O
Synonyms:- (4S,5S)-3,3-Difluoro-4-hydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Deoxy-2,2-difluoro-D-erythro-pentonic Acid Gamma-lactone
CAS:Controlled ProductFormula:C5H6F2O4Color and Shape:NeatMolecular weight:168.0962-deoxy-2,2-difluoro-D-ribonic acid-1,4-lactone
CAS:2-Deoxy-2,2-difluoro-D-erythro-pentonic acid gamma-lactone is a modification of the natural pentose sugar erythrose. It is a white crystalline powder that can be used for the synthesis of oligosaccharides, polysaccharides, and other complex carbohydrates. 2DFPGL can be found in various glycosylation and methylation reactions in the synthesis of saccharides. It has been shown to act as a competitive inhibitor of glucose uptake by cells.Formula:C5H6F2O4Purity:Min. 95%Molecular weight:168.1 g/mol



