CAS 95058-81-4: Gemcitabine
Description:Gemcitabine is a nucleoside analog used primarily as an antineoplastic agent in cancer therapy. It is classified as a pyrimidine analog, specifically resembling cytidine, and is known for its ability to inhibit DNA synthesis. The chemical formula of gemcitabine is C9H11F2N3O4, and it features a fluorine atom substitution that enhances its efficacy against certain tumors. Gemcitabine is typically administered intravenously and is effective in treating various cancers, including pancreatic, lung, and bladder cancers. Its mechanism of action involves incorporation into the DNA strand during replication, leading to chain termination and ultimately inducing apoptosis in rapidly dividing cancer cells. The substance is characterized by its relatively low solubility in water, which can affect its formulation and delivery. Additionally, gemcitabine is associated with a range of side effects, including myelosuppression, nausea, and fatigue, necessitating careful monitoring during treatment. Overall, gemcitabine represents a critical component in the arsenal against specific malignancies, showcasing the importance of targeted chemotherapy in oncology.
Formula:C9H11F2N3O4
InChI:InChI=1S/C9H11F2N3O4/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17)/t4-,6-,7-/m1/s1
InChI key:InChIKey=SDUQYLNIPVEERB-QPPQHZFASA-N
SMILES:O=C1N=C(N)C=CN1C2OC(CO)C(O)C2(F)F
- Synonyms:
- Gemcitabine
- Cytidine, 2′-deoxy-2′,2′-difluoro-
- LY 188011
- DDFC
- 2′-Deoxy-2′,2′-difluorocytidine
