CAS 95061-46-4
:Triphenylethanediol
Description:
Triphenylethanediol, with the CAS number 95061-46-4, is an organic compound characterized by its structure, which features two hydroxyl (-OH) groups attached to a central ethane backbone that is further substituted with three phenyl groups. This compound is typically a white to off-white solid at room temperature and is known for its low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. Triphenylethanediol exhibits properties typical of diols, including the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. It is often utilized in various applications, including as a reagent in organic synthesis and in the development of materials due to its potential as a building block in polymer chemistry. Additionally, its unique structure may impart interesting optical properties, making it a subject of interest in fields such as materials science and photonics. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C20H18O2
InChI:InChI=1/C20H18O2/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19,21-22H/t19-/m1/s1
SMILES:c1ccc(cc1)[C@H](C(c1ccccc1)(c1ccccc1)O)O
Synonyms:- (R)-(+)-1,1,2-Triphenyl-1,2-ethanediol
- (2R)-1,1,2-triphenylethane-1,2-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(R)-1,1,2-Triphenyl-1,2-ethanediol
CAS:(R)-1,1,2-Triphenyl-1,2-ethanediolFormula:C20H18O2Purity:98%Molecular weight:290.36(R)-(+)-1,1,2-Triphenyl-1,2-ethanediol
CAS:Formula:C20H18O2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:290.36(R)-1,1,2-Triphenylethane-1,2-diol
CAS:Formula:C20H18O2Purity:97%Color and Shape:SolidMolecular weight:290.3557(R)-1,1,2-Triphenylethane-1,2-diol
CAS:(R)-1,1,2-Triphenylethane-1,2-diolFormula:C20H18O2Purity:>98%Molecular weight:290.36(R)-1,1,2-Triphenylethane-1,2-diol
CAS:Formula:C20H18O2Purity:97%Color and Shape:SolidMolecular weight:290.362(R)-(+)-1,1,2-Triphenyl-1,2-ethanediol
CAS:(R)-(+)-1,1,2-Triphenyl-1,2-ethanediol is a heterocyclic compound with a five-membered ring. It is chiral and has two stereogenic centers in its structure. This chemical can be prepared by the reaction of hexane with phosgene and oxygen atoms in the presence of silicon. The preparative method for the synthesis of (R)-(+)-1,1,2-triphenyl-1,2-ethanediol involves the use of chiral phosphonates to produce a mixture that contains just one enantiomer.Formula:C20H18O2Purity:Min. 95%Molecular weight:290.36 g/mol





