
CAS 950649-19-1
:Pyrimidine, 2-(4-piperidinyloxy)-, hydrochloride (1:2)
Description:
Pyrimidine, 2-(4-piperidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a piperidine moiety, which is a six-membered saturated ring containing one nitrogen atom, linked via an ether bond to the pyrimidine. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the piperidinyloxy group suggests potential biological activity, possibly as a ligand or in drug development. The compound's molecular structure contributes to its properties, including its reactivity, solubility, and potential interactions with biological systems. As with many pyrimidine derivatives, it may exhibit interesting pharmacological effects, making it a subject of interest in medicinal chemistry and drug design. Safety and handling precautions should be observed due to its chemical nature.
Formula:C9H13N3O·2ClH
InChI:InChI=1S/C9H13N3O.2ClH/c1-4-11-9(12-5-1)13-8-2-6-10-7-3-8;;/h1,4-5,8,10H,2-3,6-7H2;2*1H
InChI key:InChIKey=PSCAJDYZCMOCFM-UHFFFAOYSA-N
SMILES:O(C1CCNCC1)C=2N=CC=CN2.Cl
Synonyms:- 2-[(Piperidin-4-yl)oxy]pyrimidine dihydrochloride
- Pyrimidine, 2-(4-piperidinyloxy)-, hydrochloride (1:2)
- 2-(piperidin-4-yloxy)pyrimidine 2hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(piperidin-4-yloxy)pyrimidine dihydrochloride
CAS:2-(piperidin-4-yloxy)pyrimidine dihydrochlorideFormula:C9H13N3O·2ClHPurity:≥95%Molecular weight:252.14092-(Piperidin-4-Yloxy)Pyrimidine Dihydrochloride
CAS:2-(Piperidin-4-Yloxy)Pyrimidine Dihydrochloride is a nutrient that can be used for soil fertilization and weed control. It is a non-selective herbicide that inhibits the growth of all plants. This compound breaks down in the environment, so it is environmentally friendly. 2-(Piperidin-4-Yloxy)Pyrimidine Dihydrochloride can be applied to the soil or sprayed on leaves to control weeds. It is more efficient at controlling weeds than potassium chloride, which is another type of fertilizer.Formula:C9H13N3O·2HClPurity:Min. 95%Molecular weight:252.14 g/mol



