CymitQuimica logo

CAS 950762-95-5

:

PCI-34051

Description:
PCI-34051, with the CAS number 950762-95-5, is a small molecule that acts as a selective inhibitor of the protein kinase CK2 (casein kinase 2). This compound is characterized by its ability to interfere with CK2's activity, which plays a crucial role in various cellular processes, including cell proliferation, survival, and apoptosis. The inhibition of CK2 by PCI-34051 has been studied for its potential therapeutic applications, particularly in cancer treatment, as CK2 is often overexpressed in various tumors. The compound is typically characterized by its specific binding affinity to the CK2 enzyme, leading to downstream effects on signaling pathways. Additionally, PCI-34051 has been evaluated in preclinical studies for its efficacy and safety profile, highlighting its potential as a targeted therapy. As with many small molecules, its solubility, stability, and bioavailability are important factors that influence its pharmacological properties and therapeutic potential.
Formula:C17H16N2O3
InChI:InChI=1S/C17H16N2O3/c1-22-15-6-2-12(3-7-15)11-19-9-8-13-4-5-14(10-16(13)19)17(20)18-21/h2-10,21H,11H2,1H3,(H,18,20)
InChI key:AJRGHIGYPXNABY-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)CN2C=CC3=C2C=C(C=C3)C(=O)NO
Found 8 products.