CymitQuimica logo

CAS 950778-38-8

:

Boronic acid, B-[4-(1,1-dimethylethyl)-2,6-dimethylphenyl]-

Description:
Boronic acid, specifically B-[4-(1,1-dimethylethyl)-2,6-dimethylphenyl]- (CAS 950778-38-8), is an organoboron compound characterized by the presence of a boron atom bonded to a phenyl group that is further substituted with a tert-butyl group and two methyl groups. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of the bulky tert-butyl and methyl substituents can influence its solubility, reactivity, and steric hindrance, which may affect its interactions in chemical reactions. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic chemistry. Additionally, they can serve as intermediates in the synthesis of pharmaceuticals and agrochemicals. Overall, the unique structural features of this boronic acid contribute to its utility in synthetic organic chemistry and related fields.
Formula:C12H19BO2
InChI:InChI=1S/C12H19BO2/c1-8-6-10(12(3,4)5)7-9(2)11(8)13(14)15/h6-7,14-15H,1-5H3
InChI key:FIAQKPCRNZANJC-UHFFFAOYSA-N
SMILES:B(C1=C(C=C(C=C1C)C(C)(C)C)C)(O)O
Synonyms:
  • Boronic acid, B-[4-(1,1-dimethylethyl)-2,6-dimethylphenyl]-
  • (4-(tert-butyl)-2,6-dimethylphenyl)boronic acid
Found 4 products.