CymitQuimica logo

CAS 95079-19-9

:

resorufin-beta-D-galactopyranoside

Description:
Resorufin-beta-D-galactopyranoside is a synthetic chemical compound commonly used as a substrate in biochemical assays, particularly for the detection of beta-galactosidase activity. This compound is characterized by its structure, which includes a resorufin moiety linked to a beta-D-galactopyranoside unit. The resorufin part is a fluorescent dye, making this compound useful in fluorescence-based assays. Upon hydrolysis by beta-galactosidase, resorufin-beta-D-galactopyranoside releases resorufin, which exhibits strong fluorescence, allowing for sensitive detection and quantification. The compound is typically soluble in water and organic solvents, facilitating its use in various biological systems. Its applications extend to molecular biology, cell biology, and microbiology, where it serves as a valuable tool for studying gene expression and enzyme activity. Additionally, due to its fluorescent properties, it is often employed in high-throughput screening assays. Safety data should be consulted before handling, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C18H17NO8
InChI:InChI=1/C18H17NO8/c20-7-14-15(22)16(23)17(24)18(27-14)25-9-2-4-11-13(6-9)26-12-5-8(21)1-3-10(12)19-11/h1-6,14-18,20,22-24H,7H2/t14-,15+,16+,17-,18-/m1/s1
InChI key:QULZFZMEBOATFS-DISONHOPSA-N
SMILES:C1=CC2=C(C=C1O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2
Synonyms:
  • Resorufin -D-galactopyranoside
  • 3-oxo-3H-phenoxazin-7-yl beta-D-galactopyranoside
Found 6 products.