CAS 950858-06-7
:2,6-difluoro-4-iodo-phenol
Description:
2,6-Difluoro-4-iodo-phenol is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) attached to a benzene ring that is substituted with two fluorine atoms and one iodine atom. The fluorine atoms are located at the 2 and 6 positions, while the iodine atom is at the 4 position of the aromatic ring. This compound exhibits properties typical of halogenated phenols, including potential applications in pharmaceuticals, agrochemicals, and materials science due to its unique electronic and steric properties. The presence of electronegative halogens can influence the compound's reactivity, solubility, and biological activity. Additionally, the compound may exhibit interesting interactions in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Its molecular structure contributes to its potential as a building block in organic synthesis and as a precursor for more complex chemical entities. Safety and handling precautions should be observed due to the presence of halogens, which can pose health and environmental risks.
Formula:C6H3F2IO
InChI:InChI=1/C6H3F2IO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H
SMILES:c1c(cc(c(c1F)O)F)I
Synonyms:- 2,6-Difluoro-4-iodophenol
- Phenol, 2,6-difluoro-4-iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Difluoro-4-iodophenol, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3F2IOPurity:99%Color and Shape:Pale cream to cream, Crystals or powder or crystalline powderMolecular weight:255.992,6-Difluoro-4-iodophenol
CAS:2,6-Difluoro-4-iodophenolFormula:C6H3F2IOPurity:95%Molecular weight:255.992,6-Difluoro-4-iodophenol
CAS:Formula:C6H3F2IOPurity:95%Color and Shape:SolidMolecular weight:255.98872,6-Difluoro-4-iodophenol
CAS:2,6-Difluoro-4-iodophenol
Color and Shape:SolidMolecular weight:255.99g/mol




