CymitQuimica logo

CAS 95093-99-5

:

(2R)-1-(9H-carbazol-4-yloxy)-3-{[2-(2-methoxyphenoxy)ethyl]amino}propan-2-ol

Description:
The chemical substance known as (2R)-1-(9H-carbazol-4-yloxy)-3-{[2-(2-methoxyphenoxy)ethyl]amino}propan-2-ol, with the CAS number 95093-99-5, is a complex organic compound characterized by its unique structural features. It contains a carbazole moiety, which is a fused ring system known for its aromatic properties and potential applications in organic electronics and pharmaceuticals. The presence of a propanol group suggests that it may exhibit alcohol-like properties, potentially influencing its solubility and reactivity. Additionally, the compound features ether and amine functional groups, which can enhance its biological activity and interaction with various biological targets. The methoxyphenoxy group may contribute to its lipophilicity, affecting its pharmacokinetics. Overall, this compound's intricate structure indicates potential utility in medicinal chemistry, particularly in the development of therapeutic agents, although specific biological activities and applications would require further investigation through empirical studies.
Formula:C24H26N2O4
InChI:InChI=1/C24H26N2O4/c1-28-21-10-4-5-11-22(21)29-14-13-25-15-17(27)16-30-23-12-6-9-20-24(23)18-7-2-3-8-19(18)26-20/h2-12,17,25-27H,13-16H2,1H3/t17-/m1/s1
InChI key:OGHNVEJMJSYVRP-QGZVFWFLSA-N
SMILES:COc1ccccc1OCCNC[C@H](COc1cccc2c1c1ccccc1[nH]2)O
Found 8 products.