CymitQuimica logo

CAS 95095-46-8

:

2,3-diamino-5-bromo-6-(trifluoromethyl)pyrimidin-4(3H)-one

Description:
2,3-Diamino-5-bromo-6-(trifluoromethyl)pyrimidin-4(3H)-one is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features two amino groups at positions 2 and 3, a bromine atom at position 5, and a trifluoromethyl group at position 6, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or antiviral agents, due to the presence of multiple functional groups that can participate in various chemical reactions. Additionally, the bromine and trifluoromethyl substituents may impart specific reactivity and stability characteristics, making it a compound of interest in medicinal chemistry and material science.
Formula:C5H4BrF3N4O
InChI:InChI=1/C5H4BrF3N4O/c6-1-2(5(7,8)9)12-4(10)13(11)3(1)14/h11H2,(H2,10,12)
InChI key:MQGUIHMFRJISAF-UHFFFAOYSA-N
SMILES:c1(c(C(F)(F)F)[nH]c(=N)n(c1=O)N)Br
Found 2 products.