CymitQuimica logo

CAS 950984-75-5

:

N,N-Bis(2-Pyridylmethyl)-N-Propargylamine

Description:
N,N-Bis(2-Pyridylmethyl)-N-Propargylamine is a chemical compound characterized by its unique structure, which includes two pyridylmethyl groups and a propargylamine moiety. This compound typically exhibits properties associated with both amines and pyridine derivatives, such as basicity and potential coordination with metal ions due to the nitrogen atoms in the pyridine rings. The presence of the propargyl group may impart additional reactivity, particularly in terms of alkyne chemistry, allowing for various synthetic applications. This compound is often studied in the context of medicinal chemistry and coordination chemistry, where it may serve as a ligand in metal complexes or as a precursor for further chemical modifications. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, N,N-Bis(2-Pyridylmethyl)-N-Propargylamine is a versatile compound with potential uses in various fields, including catalysis and drug development.
Formula:C15H15N3
InChI:InChI=1S/C15H15N3/c1-2-11-18(12-14-7-3-5-9-16-14)13-15-8-4-6-10-17-15/h1,3-10H,11-13H2
InChI key:UKLHHECOZJWQJN-UHFFFAOYSA-N
SMILES:C#CCN(CC1=CC=CC=N1)CC2=CC=CC=N2
Found 4 products.