CymitQuimica logo

CAS 951883-95-7

:

2-Bromo-N-cyclohexylbenzenesulfonamide

Description:
2-Bromo-N-cyclohexylbenzenesulfonamide is a chemical compound characterized by the presence of a bromine atom, a cyclohexyl group, and a benzenesulfonamide functional group. This compound features a sulfonamide moiety, which is known for its biological activity and potential pharmaceutical applications. The bromine substituent introduces a halogen, which can influence the compound's reactivity and solubility. The cyclohexyl group contributes to the compound's hydrophobic characteristics, potentially affecting its interaction with biological systems. The overall structure suggests that it may exhibit interesting properties, such as antimicrobial or anti-inflammatory activities, typical of sulfonamide derivatives. Additionally, the presence of the bromine atom may enhance its lipophilicity, impacting its pharmacokinetics. As with many sulfonamides, the compound may also be subject to specific regulatory considerations due to its potential biological effects. Overall, 2-Bromo-N-cyclohexylbenzenesulfonamide represents a unique structure that could be of interest in medicinal chemistry and drug development.
Formula:C12H16BrNO2S
InChI:InChI=1S/C12H16BrNO2S/c13-11-8-4-5-9-12(11)17(15,16)14-10-6-2-1-3-7-10/h4-5,8-10,14H,1-3,6-7H2
InChI key:InChIKey=ZJNJLUIXKKZXBS-UHFFFAOYSA-N
SMILES:S(NC1CCCCC1)(=O)(=O)C2=C(Br)C=CC=C2
Synonyms:
  • 2-Bromo-N-cyclohexylbenzene-1-sulfonamide
  • Benzenesulfonamide, 2-bromo-N-cyclohexyl-
  • N-Cyclohexyl 2-bromobenzenesulfonamide
  • 2-Bromo-N-cyclohexylbenzenesulfonamide
Found 3 products.