CymitQuimica logo

CAS 951883-98-0

:

1-(2-bromophenylsulfonyl)piperidine

Description:
1-(2-Bromophenylsulfonyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing heterocycle. The presence of a sulfonyl group (-SO2-) attached to a 2-bromophenyl moiety contributes to its unique properties. This compound typically exhibits moderate to high solubility in polar organic solvents due to the sulfonyl group, which can engage in hydrogen bonding and dipole interactions. The bromine atom on the phenyl ring can influence the compound's reactivity, making it a potential electrophile in various chemical reactions. Additionally, the piperidine ring can participate in nucleophilic substitution reactions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Its specific applications and interactions would depend on further studies, including its mechanism of action and potential therapeutic uses. As with any chemical substance, proper handling and safety precautions should be observed due to its potential hazards.
Formula:C11H14BrNO2S
InChI:InChI=1S/C11H14BrNO2S/c12-10-6-2-3-7-11(10)16(14,15)13-8-4-1-5-9-13/h2-3,6-7H,1,4-5,8-9H2
InChI key:QVJWVAUVIDEPPD-UHFFFAOYSA-N
SMILES:C1CCN(CC1)S(=O)(=O)C2=CC=CC=C2Br
Found 3 products.