CAS 951884-67-6

3-Bromo-N-propyl-5-(trifluoromethyl)benzenesulfonamide

Description:

3-Bromo-N-propyl-5-(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. The presence of a bromine atom and a trifluoromethyl group on the aromatic ring significantly influences its chemical reactivity and physical properties. The bromine substituent can enhance the compound's electrophilicity, while the trifluoromethyl group often imparts unique electronic characteristics, making it a valuable moiety in drug design. The N-propyl group contributes to the compound's hydrophobicity, affecting its solubility and interaction with biological systems. This compound may exhibit antibacterial or antifungal properties, typical of many sulfonamides, and its structural features suggest potential utility in medicinal chemistry. Additionally, the presence of multiple halogen atoms can influence the compound's stability and reactivity under various conditions. Overall, 3-Bromo-N-propyl-5-(trifluoromethyl)benzenesulfonamide represents a complex molecule with diverse applications in chemical research and development.

Formula: C₁₀H₁₁BrF₃NO₂S

InChI: InChI=1S/C10H11BrF3NO2S/c1-2-3-15-18(16,17)9-5-7(10(12,13)14)4-8(11)6-9/h4-6,15H,2-3H2,1H3

InChI key: InChIKey=RASKGVJGSUZJIE-UHFFFAOYSA-N

SMILES: S(NCCC)(=O)(=O)C1=CC(C(F)(F)F)=CC(Br)=C1

Synonyms:

• 3-Bromo-N-propyl-5-(trifluoromethyl)benzenesulfonamide
• N-Propyl 3-bromo-5-trifluoromethylbenzenesulfonamide
• Benzenesulfonamide, 3-bromo-N-propyl-5-(trifluoromethyl)-

3-Bromo-5-(N-propylsulphamoyl)benzotrifluoride

CAS: 951884-67-6

3-Bromo-5-(N-propylsulphamoyl)benzotrifluoride

Formula: C₁₀H₁₁BrF₃NO₂S

Purity: ≥95%

Molecular weight: 346.16404

Ref: 54-PC8121

N-Propyl 3-bromo-5-trifluoromethylbenzenesulfonamide

CAS: 951884-67-6

Formula: C₁₀H₁₁BrF₃NO₂S

Molecular weight: 346.1640

Ref: IN-DA00IIT1