CAS 95192-64-6
:4-Bromo-2,6-dinitrotoluene
Description:
4-Bromo-2,6-dinitrotoluene (CAS 95192-64-6) is an organic compound characterized by the presence of a bromine atom and two nitro groups attached to a toluene ring. This compound is a derivative of toluene, where the bromine and nitro groups are positioned at the 4 and 2,6 positions, respectively. It typically appears as a yellow to orange crystalline solid and is known for its explosive properties, making it of interest in the field of energetic materials. The presence of nitro groups contributes to its reactivity and potential as a high-energy compound. 4-Bromo-2,6-dinitrotoluene is also notable for its applications in the synthesis of other chemical compounds and may exhibit environmental persistence. Safety precautions are essential when handling this substance due to its toxic and potentially hazardous nature. Its physical and chemical properties, such as solubility and melting point, can vary based on purity and specific conditions.
Formula:C7H5BrN2O4
InChI:InChI=1/C7H5BrN2O4/c1-4-6(9(11)12)2-5(8)3-7(4)10(13)14/h2-3H,1H3
SMILES:Cc1c(cc(cc1N(=O)=O)Br)N(=O)=O
Synonyms:- 5-Bromo-2-methyl-1,3-dinitrobenzene
- Wnr Ce F1 Enw
- 2,6-Dinitro-4-Bromo-Tolurene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-2,6-dinitrotoluene, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrN2O4Purity:97%Color and Shape:White to yellow, Crystals or powder or crystalline powderMolecular weight:261.034-Bromo-2,6-dinitrotoluene
CAS:4-Bromo-2,6-dinitrotolueneFormula:C7H5BrN2O4Purity:≥95%Color and Shape:Solid-PowderMolecular weight:261.02964-Bromo-2,6-dinitrotoluene
CAS:Formula:C7H5BrN2O4Purity:95%Color and Shape:SolidMolecular weight:261.0296




