CAS 95201-93-7
:Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
Description:
Methyl 4-bromo-3-hydroxythiophene-2-carboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a bromine atom at the 4-position and a hydroxyl group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylate group, derived from the carboxylic acid, indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. The methyl ester group enhances its solubility in organic solvents, making it useful in various chemical processes. This compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its unique structural features allow for potential applications in the development of dyes, pharmaceuticals, or agrochemicals. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with halogenated organic substances.
Formula:C6H5BrO3S
InChI:InChI=1/C6H5BrO3S/c1-10-6(9)5-4(8)3(7)2-11-5/h2,8H,1H3
SMILES:COC(=O)c1c(c(cs1)Br)O
Synonyms:- 4-bromo-2-[hydroxy(methoxy)methylidene]thiophen-3(2H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4-bromo-3-hydroxythiophene-2-carboxylate, 97%
CAS:The synthesis of the thienopyranone scaffold began with the alkylation of methyl 4-bromo-3-hydroxythiophene-2-carboxylate with N-acetylmorpholine. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refeFormula:C6H5BrO3SPurity:97%Color and Shape:White to cream or pale orange to pale brown or pink/brown to pink/red, PowderMolecular weight:237.07methyl 4-bromo-3-hydroxythiophene-2-carboxylate
CAS:methyl 4-bromo-3-hydroxythiophene-2-carboxylateFormula:C6H5BrO3SPurity:97%Molecular weight:237.0711Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
CAS:Methyl 4-bromo-3-hydroxythiophene-2-carboxylateFormula:C6H5BrO3SPurity:95%Molecular weight:237.07methyl 4-bromo-3-hydroxythiophene-2-carboxylate
CAS:Formula:C6H5BrO3SPurity:95%Color and Shape:SolidMolecular weight:237.0711Methyl 4-Bromo-3-hydroxythiophene-2-carboxylate
CAS:Formula:C6H5BrO3SPurity:97%Color and Shape:SolidMolecular weight:237.07




