CymitQuimica logo

CAS 952065-58-6

:

4,4'-[1,4-Naphthalenediyldi-(1E)-2,1-ethenediyl]bis[N,N-diphenylbenzenamine]

Description:
4,4'-[1,4-Naphthalenediyldi-(1E)-2,1-ethenediyl]bis[N,N-diphenylbenzenamine], identified by its CAS number 952065-58-6, is an organic compound characterized by its complex molecular structure, which includes naphthalene and diphenylamine moieties. This compound features a central naphthalene unit connected by vinyl linkages to two diphenylamine groups, contributing to its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). The presence of multiple aromatic rings enhances its electronic properties, making it a candidate for charge transport materials. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, depending on its molecular conformation and environment. Its synthesis typically involves multi-step organic reactions, and it may require careful handling due to potential toxicity associated with its amine groups. Overall, this compound represents a class of materials that are of significant interest in the field of organic chemistry and materials science.
Formula:C50H38N2
InChI:InChI=1S/C50H38N2/c1-5-15-43(16-6-1)51(44-17-7-2-8-18-44)47-35-27-39(28-36-47)25-31-41-33-34-42(50-24-14-13-23-49(41)50)32-26-40-29-37-48(38-30-40)52(45-19-9-3-10-20-45)46-21-11-4-12-22-46/h1-38H/b31-25+,32-26+
InChI key:ZRRUDIXIMMOTLY-YESHOFFLSA-N
SMILES:C1=CC=C(C=C1)N(C2=CC=C(C=C2)/C=C/C3=CC=C(C4=CC=CC=C34)/C=C/C5=CC=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=CC=C8
Found 1 products.