CymitQuimica logo

CAS 952068-57-4

:

Parishin E

Description:
Parishin E, identified by its CAS number 952068-57-4, is a chemical compound that belongs to the class of natural products known as polyphenols. It is primarily derived from certain plant sources, particularly those in the genus *Parishin*, which are known for their potential health benefits. The compound exhibits antioxidant properties, which can help in neutralizing free radicals and may contribute to various biological activities, including anti-inflammatory and antimicrobial effects. Its structure typically features multiple hydroxyl groups, which are responsible for its reactivity and interaction with biological systems. Research into Parishin E is ongoing, focusing on its potential applications in pharmaceuticals and nutraceuticals, as well as its role in traditional medicine. As with many natural compounds, the specific characteristics, such as solubility and stability, can vary based on environmental conditions and the presence of other substances. Further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C19H24O13
InChI:InChI=1S/C19H24O13/c20-7-11-14(24)15(25)16(26)17(32-11)31-10-3-1-9(2-4-10)8-30-13(23)6-19(29,18(27)28)5-12(21)22/h1-4,11,14-17,20,24-26,29H,5-8H2,(H,21,22)(H,27,28)/t11-,14-,15+,16-,17-,19?/m1/s1
InChI key:XAIUTKHLNZBMEG-HUNOYVTQSA-N
SMILES:C1=CC(=CC=C1COC(=O)CC(CC(=O)O)(C(=O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
Synonyms:
  • 4-[(3,4-Dicarboxy-3-hydroxy-1-oxobutoxy)methyl]phenyl beta-D-glucopyranoside
Found 8 products.