CymitQuimica logo

CAS 952188-00-0

:

5-[[4-[2-(5-ethyl-2-pyridyl)ethoxy]phenyl]methyl]-3-[2-(5-ethyl-2-pyridyl)ethyl]thiazolidine-2,4-dione

Description:
The chemical substance known as "5-[[4-[2-(5-ethyl-2-pyridyl)ethoxy]phenyl]methyl]-3-[2-(5-ethyl-2-pyridyl)ethyl]thiazolidine-2,4-dione" with the CAS number 952188-00-0 is a thiazolidinedione derivative, which is a class of compounds known for their potential therapeutic applications, particularly in the treatment of diabetes and metabolic disorders. This compound features a thiazolidine ring, which is characterized by a five-membered ring containing sulfur and nitrogen atoms, and is substituted with various functional groups that enhance its biological activity. The presence of ethyl-2-pyridyl moieties suggests potential interactions with biological targets, possibly influencing its pharmacokinetics and pharmacodynamics. The compound's structure indicates it may exhibit lipophilicity due to the aromatic and aliphatic components, which can affect its solubility and absorption characteristics. Overall, the specific arrangement of functional groups in this molecule is likely to contribute to its unique properties and potential efficacy in medicinal chemistry.
Formula:C28H31N3O3S
InChI:InChI=1/C28H31N3O3S/c1-3-20-5-9-23(29-18-20)13-15-31-27(32)26(35-28(31)33)17-22-7-11-25(12-8-22)34-16-14-24-10-6-21(4-2)19-30-24/h5-12,18-19,26H,3-4,13-17H2,1-2H3
InChI key:UICSFXCWECATJX-UHFFFAOYSA-N
SMILES:CCc1ccc(CCN2C(=O)C(Cc3ccc(cc3)OCCc3ccc(CC)cn3)SC2=O)nc1
Found 8 products.