CymitQuimica logo

CAS 952514-86-2

:

1-Phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazole

Description:
1-Phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazole is a complex organic compound characterized by its unique structural features, which include a benzimidazole core and a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests potential applications in organic synthesis and materials science, particularly in the development of boron-based reagents or catalysts. This compound is likely to exhibit interesting electronic properties due to the conjugated system formed by the phenyl and benzimidazole rings, which may enhance its utility in optoelectronic applications. Additionally, the boron atom can participate in coordination chemistry, making it a candidate for further functionalization or incorporation into larger molecular frameworks. The stability and reactivity of this compound can be influenced by the steric and electronic effects of the substituents, particularly the bulky tetramethyl groups. Overall, this compound represents a valuable structure for research in organic chemistry and materials science, with potential implications in drug development and sensor technology.
Formula:C25H25BN2O2
InChI:InChI=1S/C25H25BN2O2/c1-24(2)25(3,4)30-26(29-24)19-12-10-11-18(17-19)23-27-21-15-8-9-16-22(21)28(23)20-13-6-5-7-14-20/h5-17H,1-4H3
InChI key:IFFQSTWSRPRHBQ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=NC4=CC=CC=C4N3C5=CC=CC=C5
Synonyms:
  • 3-(1-Phenyl-1H-benzimidazole-2-yl)phenylboronic acid pinacol ester
Found 5 products.