CAS 95258-15-4

Yadanzioside A

Description:

Yadanzioside A, with the CAS number 95258-15-4, is a natural glycoside compound primarily derived from certain plant species, particularly those in the genus Yadanzi. This compound is characterized by its complex molecular structure, which typically includes a sugar moiety linked to a non-sugar aglycone. Yadanzioside A is known for its potential pharmacological properties, including anti-inflammatory and antioxidant activities, making it of interest in medicinal chemistry and natural product research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its bioavailability and efficacy in biological systems. Additionally, like many glycosides, it may exhibit specific interactions with biological targets, contributing to its therapeutic potential. Research into Yadanzioside A continues to explore its mechanisms of action and possible applications in health and disease management.

Formula: C₃₂H₄₄O₁₆

InChI: InChI=1S/C32H44O16/c1-11(2)6-17(34)48-23-25-31-10-44-32(25,29(42)43-5)26(40)22(39)24(31)30(4)8-14(18(35)12(3)13(30)7-16(31)47-27(23)41)45-28-21(38)20(37)19(36)15(9-33)46-28/h8,11-13,15-16,19-26,28,33,36-40H,6-7,9-10H2,1-5H3/t12-,13-,15+,16+,19+,20-,21+,22+,23+,24+,25+,26-,28+,30-,31+,32-/m0/s1

InChI key: InChIKey=QDQJWSSPAMZRIA-TUHDNREHSA-N

SMILES: C(OC)(=O)[C@]12[C@]3([C@]4([C@@]([C@]5(C)[C@@](C[C@]4(OC(=O)[C@@H]3OC(CC(C)C)=O)[H])([C@H](C)C(=O)C(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)=C5)[H])([C@@H](O)[C@@H]1O)[H])CO2)[H]

Synonyms:

• Picras-1-en-21-oic acid, 13,20-epoxy-2-(β-D-glucopyranosyloxy)-11,12-dihydroxy-15-(3-methyl-1-oxobutoxy)-3,16-dioxo-, methyl ester, (11β,12α,15β)-
• 2H-3,11c-(Epoxymethano)phenanthro[10,1-bc]pyran, picras-1-en-21-oic acid deriv.
• Yadanzioside A

YadanziosideA

CAS: 95258-15-4

Formula: C₃₂H₄₄O₁₆

Purity: 98.0%

Molecular weight: 684.6822

Ref: IN-DA01DDGQ

Yadanzioside A

CAS: 95258-15-4

Yadanzioside A

Purity: ≥98%

Molecular weight: 684.68g/mol

Ref: 54-BUP20821

Yadanzioside A

CAS: 95258-15-4

Formula: C₃₂H₄₄O₁₆

Molecular weight: 684.69

Ref: 7W-GY5885

Yadanzioside A

CAS: 95258-15-4

Yadanzioside A is a triterpenoid compound extracted from Brucea javanica, demonstrating antitumor activity and used in leukemia research.

Formula: C₃₂H₄₄O₁₆

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 684.68

Ref: TM-TN2319

Yadanzioside A

CAS: 95258-15-4

Formula: C₃₂H₄₄O₁₆

Purity: 95%~99%

Molecular weight: 684.688

Ref: BP-BP3460

Yadanzioside A

CAS: 95258-15-4

Yadanzioside A is a natural compound, which is a cardenolide glycoside derived from the seeds of the plant Cerbera manghas. It functions primarily through inhibition of the Na+/K+-ATPase pump, a mechanism similar to that observed in other cardiac glycosides, leading to increased intracellular calcium levels. This process can induce positive inotropic effects, which are of interest in the context of cardiac research.

Formula: C₃₂H₄₄O₁₆

Purity: Min. 95%

Molecular weight: 684.69 g/mol

Ref: 3D-VDA25815