CymitQuimica logo

CAS 95258-15-4

:

Yadanzioside A

Description:
Yadanzioside A, with the CAS number 95258-15-4, is a natural glycoside compound primarily derived from certain plant species, particularly those in the genus Yadanzi. This compound is characterized by its complex molecular structure, which typically includes a sugar moiety linked to a non-sugar aglycone. Yadanzioside A is known for its potential pharmacological properties, including anti-inflammatory and antioxidant activities, making it of interest in medicinal chemistry and natural product research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its bioavailability and efficacy in biological systems. Additionally, like many glycosides, it may exhibit specific interactions with biological targets, contributing to its therapeutic potential. Research into Yadanzioside A continues to explore its mechanisms of action and possible applications in health and disease management.
Formula:C32H44O16
InChI:InChI=1S/C32H44O16/c1-11(2)6-17(34)48-23-25-31-10-44-32(25,29(42)43-5)26(40)22(39)24(31)30(4)8-14(18(35)12(3)13(30)7-16(31)47-27(23)41)45-28-21(38)20(37)19(36)15(9-33)46-28/h8,11-13,15-16,19-26,28,33,36-40H,6-7,9-10H2,1-5H3/t12-,13-,15+,16+,19+,20-,21+,22+,23+,24+,25+,26-,28+,30-,31+,32-/m0/s1
InChI key:InChIKey=QDQJWSSPAMZRIA-TUHDNREHSA-N
SMILES:C(OC)(=O)[C@]12[C@]3([C@]4([C@@]([C@]5(C)[C@@](C[C@]4(OC(=O)[C@@H]3OC(CC(C)C)=O)[H])([C@H](C)C(=O)C(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)=C5)[H])([C@@H](O)[C@@H]1O)[H])CO2)[H]
Synonyms:
  • Picras-1-en-21-oic acid, 13,20-epoxy-2-(β-D-glucopyranosyloxy)-11,12-dihydroxy-15-(3-methyl-1-oxobutoxy)-3,16-dioxo-, methyl ester, (11β,12α,15β)-
  • 2H-3,11c-(Epoxymethano)phenanthro[10,1-bc]pyran, picras-1-en-21-oic acid deriv.
  • Yadanzioside A
Found 7 products.