CAS 95258-16-5
:Yadanzioside C
Description:
Yadanzioside C, with the CAS number 95258-16-5, is a triterpenoid saponin derived from the plant species Yadanzi, known for its traditional medicinal uses. This compound exhibits a complex glycosidic structure, which contributes to its biological activity. Yadanzioside C is characterized by its ability to interact with cell membranes, potentially influencing membrane permeability and cellular signaling pathways. It has been studied for its pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The presence of sugar moieties in its structure enhances its solubility in water, which may facilitate its bioavailability. Additionally, like many saponins, Yadanzioside C may exhibit hemolytic activity, which is a common characteristic of saponins due to their surfactant properties. Research into Yadanzioside C continues to explore its therapeutic potential and mechanisms of action, making it a compound of interest in natural product chemistry and pharmacology.
Formula:C34H46O17
InChI:InChI=1S/C34H46O17/c1-12(31(3,4)45)7-18(36)51-24-26-33-11-47-34(26,30(44)46-6)27(42)23(41)25(33)32(5)9-15(19(37)13(2)14(32)8-17(33)50-28(24)43)48-29-22(40)21(39)20(38)16(10-35)49-29/h7,9,13-14,16-17,20-27,29,35,38-42,45H,8,10-11H2,1-6H3/b12-7+/t13-,14-,16+,17+,20+,21-,22+,23+,24+,25+,26+,27-,29+,32-,33+,34-/m0/s1
InChI key:InChIKey=HOEZNQMKHRGGTI-ZJNUUKDLSA-N
SMILES:C(OC)(=O)[C@]12[C@]3([C@]4([C@@]([C@]5(C)[C@@](C[C@]4(OC(=O)[C@@H]3OC(/C=C(/C(C)(C)O)\C)=O)[H])([C@H](C)C(=O)C(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)=C5)[H])([C@@H](O)[C@@H]1O)[H])CO2)[H]
Synonyms:- Yadanzioside C
- Picras-1-en-21-oic acid, 13,20-epoxy-2-(β-D-glucopyranosyloxy)-11,12-dihydroxy-15-[(4-hydroxy-3,4-dimethyl-1-oxo-2-pentenyl)oxy]-3,16-dioxo-, methyl ester, [11β,12α,15β(E)]-
- 2H-3,11c-(Epoxymethano)phenanthro[10,1-bc]pyran, picras-1-en-21-oic acid deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Yadanzioside C
CAS:Yadanzioside C is a quassinoid and terpenoid,Brucea javanica, inhibit InhA enzyme (Mycobacterium enoyl acyl carrier protein reductase),anti-tuberculosis.Formula:C34H46O17Purity:99.96%Color and Shape:SolidMolecular weight:726.72Yadanzioside C
CAS:Yadanzioside C is a naturally occurring glycoside, which is derived from certain plant species known for their medicinal properties, such as those belonging to the genus Brucea. This compound exhibits its pharmacological effects primarily through its ability to interact with cellular pathways involved in apoptosis and cell proliferation. By modulating these pathways, Yadanzioside C can induce programmed cell death in cancerous cells, offering potential therapeutic benefits in oncology.Formula:C34H46O17Purity:Min. 95%Molecular weight:726.7 g/molPicras-1-en-21-oic acid, 13,20-epoxy-2-(β-D-glucopyranosyloxy)-11,12-dihydroxy-15-[(4-hydroxy-3,4-dimethyl-1-oxo-2-pentenyl)oxy]-3,16-dioxo-, methyl ester, [11β,12α,15β(E)]-
CAS:Formula:C34H46O17Purity:98.0%Molecular weight:726.7188





