CymitQuimica logo

CAS 952800-37-2

:

methyl 3-bromo-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylate

Description:
Methyl 3-bromo-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrrolopyridine framework. This compound features a bromine atom and a trifluoromethyl group, which contribute to its unique reactivity and physical properties. The presence of the carboxylate ester functional group indicates that it can participate in various chemical reactions, such as nucleophilic substitutions or hydrolysis. The trifluoromethyl group is known for enhancing lipophilicity and biological activity, making this compound of interest in medicinal chemistry and drug development. Additionally, the bromine substituent can serve as a site for further functionalization, allowing for the synthesis of derivatives with potentially diverse applications. Overall, this compound's structural features suggest it may exhibit interesting pharmacological properties, warranting further investigation in the context of drug discovery and development.
Formula:C10H6BrF3N2O2
InChI:InChI=1/C10H6BrF3N2O2/c1-18-9(17)7-6(11)4-2-3-5(10(12,13)14)15-8(4)16-7/h2-3H,1H3,(H,15,16)
InChI key:XRVMZHISSGDOPE-UHFFFAOYSA-N
SMILES:COC(=O)c1c(c2ccc(C(F)(F)F)nc2[nH]1)Br
Found 2 products.